C25H21F3N2O4S — CID 30559584
2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 30559584) has the molecular formula C25H21F3N2O4S and a molecular weight of 502.51 g/mol. Its IUPAC name is 2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 30559584 |
| Molecular Formula | C25H21F3N2O4S |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | Cc1ccc(CS(=O)(=O)c2cn(CC(=O)Nc3ccc(OC(F)(F)F)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H21F3N2O4S/c1-17-6-8-18(9-7-17)16-35(32,33)23-14-30(22-5-3-2-4-21(22)23)15-24(31)29-19-10-12-20(13-11-19)34-25(26,27)28/h2-14H,15-16H2,1H3,(H,29,31) |
| InChIKey | VPPZVRFSQQEIJV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |