C27H26N2O5S — CID 18559888
2-[3-(4-ethoxyphenyl)sulfonyl-4-oxoquinolin-1-yl]-N-(4-ethylphenyl)acetamide (PubChem CID 18559888) has the molecular formula C27H26N2O5S and a molecular weight of 490.58 g/mol. Its IUPAC name is 2-[3-(4-ethoxyphenyl)sulfonyl-4-oxoquinolin-1-yl]-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-[3-(4-ethoxyphenyl)sulfonyl-4-oxoquinolin-1-yl]-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 18559888 |
| Molecular Formula | C27H26N2O5S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 2-[3-(4-ethoxyphenyl)sulfonyl-4-oxoquinolin-1-yl]-N-(4-ethylphenyl)acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)c2cn(CC(=O)Nc3ccc(CC)cc3)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C27H26N2O5S/c1-3-19-9-11-20(12-10-19)28-26(30)18-29-17-25(27(31)23-7-5-6-8-24(23)29)35(32,33)22-15-13-21(14-16-22)34-4-2/h5-17H,3-4,18H2,1-2H3,(H,28,30) |
| InChIKey | LZAYHCMIHSXNFA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |