C26H24N2O6S — CID 16825265
2-[3-(4-ethoxyphenyl)sulfonyl-4-oxoquinolin-1-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 16825265) has the molecular formula C26H24N2O6S and a molecular weight of 492.55 g/mol. Its IUPAC name is 2-[3-(4-ethoxyphenyl)sulfonyl-4-oxoquinolin-1-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[3-(4-ethoxyphenyl)sulfonyl-4-oxoquinolin-1-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 16825265 |
| Molecular Formula | C26H24N2O6S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 2-[3-(4-ethoxyphenyl)sulfonyl-4-oxoquinolin-1-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)c2cn(CC(=O)Nc3ccc(OC)cc3)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C26H24N2O6S/c1-3-34-20-12-14-21(15-13-20)35(31,32)24-16-28(23-7-5-4-6-22(23)26(24)30)17-25(29)27-18-8-10-19(33-2)11-9-18/h4-16H,3,17H2,1-2H3,(H,27,29) |
| InChIKey | DIBVSJUKBYQFDN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |