C25H24N2O3S — CID 16935668
N-(3,4-dimethylphenyl)-2-[3-(4-methylphenyl)sulfonylindol-1-yl]acetamide (PubChem CID 16935668) has the molecular formula C25H24N2O3S and a molecular weight of 432.55 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[3-(4-methylphenyl)sulfonylindol-1-yl]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[3-(4-methylphenyl)sulfonylindol-1-yl]acetamide |
|---|---|
| PubChem CID | 16935668 |
| Molecular Formula | C25H24N2O3S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[3-(4-methylphenyl)sulfonylindol-1-yl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)c2cn(CC(=O)Nc3ccc(C)c(C)c3)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H24N2O3S/c1-17-8-12-21(13-9-17)31(29,30)24-15-27(23-7-5-4-6-22(23)24)16-25(28)26-20-11-10-18(2)19(3)14-20/h4-15H,16H2,1-3H3,(H,26,28) |
| InChIKey | NCNZOIQKJLNQEL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |