C22H16ClFN2O3S — CID 16936042
N-(3-chlorophenyl)-2-[3-(4-fluorophenyl)sulfonylindol-1-yl]acetamide (PubChem CID 16936042) has the molecular formula C22H16ClFN2O3S and a molecular weight of 442.90 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[3-(4-fluorophenyl)sulfonylindol-1-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[3-(4-fluorophenyl)sulfonylindol-1-yl]acetamide |
|---|---|
| PubChem CID | 16936042 |
| Molecular Formula | C22H16ClFN2O3S |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | N-(3-chlorophenyl)-2-[3-(4-fluorophenyl)sulfonylindol-1-yl]acetamide |
| SMILES | O=C(Cn1cc(S(=O)(=O)c2ccc(F)cc2)c2ccccc21)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H16ClFN2O3S/c23-15-4-3-5-17(12-15)25-22(27)14-26-13-21(19-6-1-2-7-20(19)26)30(28,29)18-10-8-16(24)9-11-18/h1-13H,14H2,(H,25,27) |
| InChIKey | SZLDRQFCFMUZPG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |