C16H15F2NO4S — CID 22774734
propyl 4-[(3,4-difluorophenyl)sulfonylamino]benzoate (PubChem CID 22774734) has the molecular formula C16H15F2NO4S and a molecular weight of 355.36 g/mol. Its IUPAC name is propyl 4-[(3,4-difluorophenyl)sulfonylamino]benzoate.
| Compound Name | propyl 4-[(3,4-difluorophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 22774734 |
| Molecular Formula | C16H15F2NO4S |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | propyl 4-[(3,4-difluorophenyl)sulfonylamino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C16H15F2NO4S/c1-2-9-23-16(20)11-3-5-12(6-4-11)19-24(21,22)13-7-8-14(17)15(18)10-13/h3-8,10,19H,2,9H2,1H3 |
| InChIKey | LFHSRMCUEIOBQL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |