C19H19F2NO5S — CID 25048331
(3,3-dimethyl-2-oxobutyl) 4-[(3,4-difluorophenyl)sulfonylamino]benzoate (PubChem CID 25048331) has the molecular formula C19H19F2NO5S and a molecular weight of 411.43 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 4-[(3,4-difluorophenyl)sulfonylamino]benzoate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 4-[(3,4-difluorophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 25048331 |
| Molecular Formula | C19H19F2NO5S |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 4-[(3,4-difluorophenyl)sulfonylamino]benzoate |
| SMILES | CC(C)(C)C(=O)COC(=O)c1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C19H19F2NO5S/c1-19(2,3)17(23)11-27-18(24)12-4-6-13(7-5-12)22-28(25,26)14-8-9-15(20)16(21)10-14/h4-10,22H,11H2,1-3H3 |
| InChIKey | UDTRPSVCMCMMTL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |