C19H20INO5S — CID 25040301
(3,3-dimethyl-2-oxobutyl) 3-[(4-iodophenyl)sulfamoyl]benzoate (PubChem CID 25040301) has the molecular formula C19H20INO5S and a molecular weight of 501.34 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 3-[(4-iodophenyl)sulfamoyl]benzoate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 3-[(4-iodophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 25040301 |
| Molecular Formula | C19H20INO5S |
| Molecular Weight | 501.34 g/mol |
| Exact Mass | 501.01 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 3-[(4-iodophenyl)sulfamoyl]benzoate |
| SMILES | CC(C)(C)C(=O)COC(=O)c1cccc(S(=O)(=O)Nc2ccc(I)cc2)c1 |
| InChI | InChI=1S/C19H20INO5S/c1-19(2,3)17(22)12-26-18(23)13-5-4-6-16(11-13)27(24,25)21-15-9-7-14(20)8-10-15/h4-11,21H,12H2,1-3H3 |
| InChIKey | BMWKVAYWNZFLBO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|