C19H17FN2O6S — CID 2631595
[2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate (PubChem CID 2631595) has the molecular formula C19H17FN2O6S and a molecular weight of 420.42 g/mol. Its IUPAC name is [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate.
| Compound Name | [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2631595 |
| Molecular Formula | C19H17FN2O6S |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate |
| SMILES | O=C(OCC(=O)N1CCCC1=O)c1cccc(S(=O)(=O)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H17FN2O6S/c20-14-6-8-15(9-7-14)21-29(26,27)16-4-1-3-13(11-16)19(25)28-12-18(24)22-10-2-5-17(22)23/h1,3-4,6-9,11,21H,2,5,10,12H2 |
| InChIKey | HFFLVBVYMVGFCD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |