C19H12F4N2O3S — CID 24636502
N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-2,4-difluorobenzamide (PubChem CID 24636502) has the molecular formula C19H12F4N2O3S and a molecular weight of 424.38 g/mol. Its IUPAC name is N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 24636502 |
| Molecular Formula | C19H12F4N2O3S |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-2,4-difluorobenzamide |
| SMILES | O=C(Nc1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H12F4N2O3S/c20-11-1-7-15(17(22)9-11)19(26)24-12-2-4-13(5-3-12)25-29(27,28)14-6-8-16(21)18(23)10-14/h1-10,25H,(H,24,26) |
| InChIKey | RJLTUAJFQPOWJU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |