C19H13F3N2O3S — CID 55349327
N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-2-fluorobenzamide (PubChem CID 55349327) has the molecular formula C19H13F3N2O3S and a molecular weight of 406.39 g/mol. Its IUPAC name is N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 55349327 |
| Molecular Formula | C19H13F3N2O3S |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | N-[4-[(3,4-difluorophenyl)sulfonylamino]phenyl]-2-fluorobenzamide |
| SMILES | O=C(Nc1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)cc1)c1ccccc1F |
| InChI | InChI=1S/C19H13F3N2O3S/c20-16-4-2-1-3-15(16)19(25)23-12-5-7-13(8-6-12)24-28(26,27)14-9-10-17(21)18(22)11-14/h1-11,24H,(H,23,25) |
| InChIKey | OYYMEMLKWXPGRA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |