C24H18ClN3O5S — CID 42014553
N-[4-[[4-[(4-chlorophenyl)sulfamoyl]benzoyl]amino]phenyl]furan-2-carboxamide (PubChem CID 42014553) has the molecular formula C24H18ClN3O5S and a molecular weight of 495.94 g/mol. Its IUPAC name is N-[4-[[4-[(4-chlorophenyl)sulfamoyl]benzoyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[4-[(4-chlorophenyl)sulfamoyl]benzoyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42014553 |
| Molecular Formula | C24H18ClN3O5S |
| Molecular Weight | 495.94 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | N-[4-[[4-[(4-chlorophenyl)sulfamoyl]benzoyl]amino]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=O)c2ccco2)cc1)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H18ClN3O5S/c25-17-5-7-20(8-6-17)28-34(31,32)21-13-3-16(4-14-21)23(29)26-18-9-11-19(12-10-18)27-24(30)22-2-1-15-33-22/h1-15,28H,(H,26,29)(H,27,30) |
| InChIKey | NTCGCRDJTZFGKI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.94 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |