C13H13ClN2O4S — CID 107650719
N-[3-(2-chloroethylsulfonylamino)phenyl]furan-2-carboxamide (PubChem CID 107650719) has the molecular formula C13H13ClN2O4S and a molecular weight of 328.78 g/mol. Its IUPAC name is N-[3-(2-chloroethylsulfonylamino)phenyl]furan-2-carboxamide.
| Compound Name | N-[3-(2-chloroethylsulfonylamino)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 107650719 |
| Molecular Formula | C13H13ClN2O4S |
| Molecular Weight | 328.78 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | N-[3-(2-chloroethylsulfonylamino)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(NS(=O)(=O)CCCl)c1)c1ccco1 |
| InChI | InChI=1S/C13H13ClN2O4S/c14-6-8-21(18,19)16-11-4-1-3-10(9-11)15-13(17)12-5-2-7-20-12/h1-5,7,9,16H,6,8H2,(H,15,17) |
| InChIKey | TVHWVCUECWOVIM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.78 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|