C23H18ClN3O6S — CID 24672563
N-[3-[[4-chloro-3-(furan-2-ylmethylsulfamoyl)benzoyl]amino]phenyl]furan-2-carboxamide (PubChem CID 24672563) has the molecular formula C23H18ClN3O6S and a molecular weight of 499.93 g/mol. Its IUPAC name is N-[3-[[4-chloro-3-(furan-2-ylmethylsulfamoyl)benzoyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[4-chloro-3-(furan-2-ylmethylsulfamoyl)benzoyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 24672563 |
| Molecular Formula | C23H18ClN3O6S |
| Molecular Weight | 499.93 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | N-[3-[[4-chloro-3-(furan-2-ylmethylsulfamoyl)benzoyl]amino]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)c2ccco2)c1)c1ccc(Cl)c(S(=O)(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C23H18ClN3O6S/c24-19-9-8-15(12-21(19)34(30,31)25-14-18-6-2-10-32-18)22(28)26-16-4-1-5-17(13-16)27-23(29)20-7-3-11-33-20/h1-13,25H,14H2,(H,26,28)(H,27,29) |
| InChIKey | PDTALPUARLVFAH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.93 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |