C21H21ClN4O4S — CID 38853493
4-chloro-3-(furan-2-ylmethylsulfamoyl)-N-(6-pyrrolidin-1-yl-3-pyridinyl)benzamide (PubChem CID 38853493) has the molecular formula C21H21ClN4O4S and a molecular weight of 460.94 g/mol. Its IUPAC name is 4-chloro-3-(furan-2-ylmethylsulfamoyl)-N-(6-pyrrolidin-1-yl-3-pyridinyl)benzamide.
| Compound Name | 4-chloro-3-(furan-2-ylmethylsulfamoyl)-N-(6-pyrrolidin-1-yl-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 38853493 |
| Molecular Formula | C21H21ClN4O4S |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 4-chloro-3-(furan-2-ylmethylsulfamoyl)-N-(6-pyrrolidin-1-yl-3-pyridinyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)nc1)c1ccc(Cl)c(S(=O)(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C21H21ClN4O4S/c22-18-7-5-15(12-19(18)31(28,29)24-14-17-4-3-11-30-17)21(27)25-16-6-8-20(23-13-16)26-9-1-2-10-26/h3-8,11-13,24H,1-2,9-10,14H2,(H,25,27) |
| InChIKey | NCHFGXUXHBWATA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |