C18H11ClF5N3O4S — CID 55350553
2-chloro-N-(furan-2-ylmethyl)-5-[(2,3,4,5,6-pentafluoroanilino)carbamoyl]benzenesulfonamide (PubChem CID 55350553) has the molecular formula C18H11ClF5N3O4S and a molecular weight of 495.81 g/mol. Its IUPAC name is 2-chloro-N-(furan-2-ylmethyl)-5-[(2,3,4,5,6-pentafluoroanilino)carbamoyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-(furan-2-ylmethyl)-5-[(2,3,4,5,6-pentafluoroanilino)carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55350553 |
| Molecular Formula | C18H11ClF5N3O4S |
| Molecular Weight | 495.81 g/mol |
| Exact Mass | 495.01 |
| IUPAC Name | 2-chloro-N-(furan-2-ylmethyl)-5-[(2,3,4,5,6-pentafluoroanilino)carbamoyl]benzenesulfonamide |
| SMILES | O=C(NNc1c(F)c(F)c(F)c(F)c1F)c1ccc(Cl)c(S(=O)(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C18H11ClF5N3O4S/c19-10-4-3-8(6-11(10)32(29,30)25-7-9-2-1-5-31-9)18(28)27-26-17-15(23)13(21)12(20)14(22)16(17)24/h1-6,25-26H,7H2,(H,27,28) |
| InChIKey | UVUKZJWKAWFVTR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.81 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|