C18H14ClFN2O4S — CID 9146107
N-(3-chloro-2-fluorophenyl)-4-(furan-2-ylmethylsulfamoyl)benzamide (PubChem CID 9146107) has the molecular formula C18H14ClFN2O4S and a molecular weight of 408.84 g/mol. Its IUPAC name is N-(3-chloro-2-fluorophenyl)-4-(furan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-(3-chloro-2-fluorophenyl)-4-(furan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 9146107 |
| Molecular Formula | C18H14ClFN2O4S |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | N-(3-chloro-2-fluorophenyl)-4-(furan-2-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(Nc1cccc(Cl)c1F)c1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C18H14ClFN2O4S/c19-15-4-1-5-16(17(15)20)22-18(23)12-6-8-14(9-7-12)27(24,25)21-11-13-3-2-10-26-13/h1-10,21H,11H2,(H,22,23) |
| InChIKey | LYUSSLNOKWMUQD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |