C20H19ClN2O4S — CID 9217544
N-[2-(4-chlorophenyl)ethyl]-4-(furan-2-ylmethylsulfamoyl)benzamide (PubChem CID 9217544) has the molecular formula C20H19ClN2O4S and a molecular weight of 418.90 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-4-(furan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-4-(furan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 9217544 |
| Molecular Formula | C20H19ClN2O4S |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-4-(furan-2-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)c1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C20H19ClN2O4S/c21-17-7-3-15(4-8-17)11-12-22-20(24)16-5-9-19(10-6-16)28(25,26)23-14-18-2-1-13-27-18/h1-10,13,23H,11-12,14H2,(H,22,24) |
| InChIKey | WSKBGYPNGJSUMM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |