C19H16Cl2N2O4S — CID 36866343
4-chloro-N-[(4-chlorophenyl)methyl]-3-(furan-2-ylmethylsulfamoyl)benzamide (PubChem CID 36866343) has the molecular formula C19H16Cl2N2O4S and a molecular weight of 439.32 g/mol. Its IUPAC name is 4-chloro-N-[(4-chlorophenyl)methyl]-3-(furan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | 4-chloro-N-[(4-chlorophenyl)methyl]-3-(furan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 36866343 |
| Molecular Formula | C19H16Cl2N2O4S |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | 4-chloro-N-[(4-chlorophenyl)methyl]-3-(furan-2-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1ccc(Cl)c(S(=O)(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C19H16Cl2N2O4S/c20-15-6-3-13(4-7-15)11-22-19(24)14-5-8-17(21)18(10-14)28(25,26)23-12-16-2-1-9-27-16/h1-10,23H,11-12H2,(H,22,24) |
| InChIKey | UKPWYHGFQIJTJK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |