C22H20ClN3O7S — CID 4655574
[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3-(benzylsulfamoyl)-4-chlorobenzoate (PubChem CID 4655574) has the molecular formula C22H20ClN3O7S and a molecular weight of 505.94 g/mol. Its IUPAC name is [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3-(benzylsulfamoyl)-4-chlorobenzoate.
| Compound Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3-(benzylsulfamoyl)-4-chlorobenzoate |
|---|---|
| PubChem CID | 4655574 |
| Molecular Formula | C22H20ClN3O7S |
| Molecular Weight | 505.94 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3-(benzylsulfamoyl)-4-chlorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)c(S(=O)(=O)NCc2ccccc2)c1)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C22H20ClN3O7S/c23-18-9-8-16(11-19(18)34(30,31)25-12-15-5-2-1-3-6-15)21(28)33-14-20(27)26-22(29)24-13-17-7-4-10-32-17/h1-11,25H,12-14H2,(H2,24,26,27,29) |
| InChIKey | GVFQHXCSYPSMEV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.94 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |