C19H14ClN3O4S — CID 36717175
4-chloro-N-(3-cyanophenyl)-3-(furan-2-ylmethylsulfamoyl)benzamide (PubChem CID 36717175) has the molecular formula C19H14ClN3O4S and a molecular weight of 415.86 g/mol. Its IUPAC name is 4-chloro-N-(3-cyanophenyl)-3-(furan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | 4-chloro-N-(3-cyanophenyl)-3-(furan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 36717175 |
| Molecular Formula | C19H14ClN3O4S |
| Molecular Weight | 415.86 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 4-chloro-N-(3-cyanophenyl)-3-(furan-2-ylmethylsulfamoyl)benzamide |
| SMILES | N#Cc1cccc(NC(=O)c2ccc(Cl)c(S(=O)(=O)NCc3ccco3)c2)c1 |
| InChI | InChI=1S/C19H14ClN3O4S/c20-17-7-6-14(19(24)23-15-4-1-3-13(9-15)11-21)10-18(17)28(25,26)22-12-16-5-2-8-27-16/h1-10,22H,12H2,(H,23,24) |
| InChIKey | GBJBHIHMCOGWMQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.86 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |