C23H22N4O4S — CID 38760567
N-[2-(3,5-dimethylpyrazol-1-yl)phenyl]-4-(furan-2-ylmethylsulfamoyl)benzamide (PubChem CID 38760567) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpyrazol-1-yl)phenyl]-4-(furan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-[2-(3,5-dimethylpyrazol-1-yl)phenyl]-4-(furan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 38760567 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-[2-(3,5-dimethylpyrazol-1-yl)phenyl]-4-(furan-2-ylmethylsulfamoyl)benzamide |
| SMILES | Cc1cc(C)n(-c2ccccc2NC(=O)c2ccc(S(=O)(=O)NCc3ccco3)cc2)n1 |
| InChI | InChI=1S/C23H22N4O4S/c1-16-14-17(2)27(26-16)22-8-4-3-7-21(22)25-23(28)18-9-11-20(12-10-18)32(29,30)24-15-19-6-5-13-31-19/h3-14,24H,15H2,1-2H3,(H,25,28) |
| InChIKey | CYAYERPXJTXFGL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 106.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |