C14H12ClNO5 — CID 2715177
[2-(3-chloro-4-methoxyanilino)-2-oxoethyl] furan-2-carboxylate (PubChem CID 2715177) has the molecular formula C14H12ClNO5 and a molecular weight of 309.70 g/mol. Its IUPAC name is [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] furan-2-carboxylate.
| Compound Name | [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 2715177 |
| Molecular Formula | C14H12ClNO5 |
| Molecular Weight | 309.70 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] furan-2-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2ccco2)cc1Cl |
| InChI | InChI=1S/C14H12ClNO5/c1-19-11-5-4-9(7-10(11)15)16-13(17)8-21-14(18)12-3-2-6-20-12/h2-7H,8H2,1H3,(H,16,17) |
| InChIKey | CWSTVDZVBNRRHW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.70 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |