C14H16ClNO4 — CID 5006665
[2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-methylcyclopropane-1-carboxylate (PubChem CID 5006665) has the molecular formula C14H16ClNO4 and a molecular weight of 297.74 g/mol. Its IUPAC name is [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-methylcyclopropane-1-carboxylate.
| Compound Name | [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 5006665 |
| Molecular Formula | C14H16ClNO4 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-methylcyclopropane-1-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)C2CC2C)cc1Cl |
| InChI | InChI=1S/C14H16ClNO4/c1-8-5-10(8)14(18)20-7-13(17)16-9-3-4-12(19-2)11(15)6-9/h3-4,6,8,10H,5,7H2,1-2H3,(H,16,17) |
| InChIKey | UNFOUWCLCXFEJB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |