C17H23BrN2S — CID 4985455
3-(4-bromo-3-methylphenyl)-1-cyclohexyl-1-prop-2-enylthiourea (PubChem CID 4985455) has the molecular formula C17H23BrN2S and a molecular weight of 367.36 g/mol. Its IUPAC name is 3-(4-bromo-3-methylphenyl)-1-cyclohexyl-1-prop-2-enylthiourea.
| Compound Name | 3-(4-bromo-3-methylphenyl)-1-cyclohexyl-1-prop-2-enylthiourea |
|---|---|
| PubChem CID | 4985455 |
| Molecular Formula | C17H23BrN2S |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 3-(4-bromo-3-methylphenyl)-1-cyclohexyl-1-prop-2-enylthiourea |
| SMILES | C=CCN(C(=S)Nc1ccc(Br)c(C)c1)C1CCCCC1 |
| InChI | InChI=1S/C17H23BrN2S/c1-3-11-20(15-7-5-4-6-8-15)17(21)19-14-9-10-16(18)13(2)12-14/h3,9-10,12,15H,1,4-8,11H2,2H3,(H,19,21) |
| InChIKey | MVCKDQJLAYSIEO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|