C15H21BrN2S — CID 3837005
3-(4-bromo-3-methylphenyl)-1-(cyclopropylmethyl)-1-propylthiourea (PubChem CID 3837005) has the molecular formula C15H21BrN2S and a molecular weight of 341.32 g/mol. Its IUPAC name is 3-(4-bromo-3-methylphenyl)-1-(cyclopropylmethyl)-1-propylthiourea.
| Compound Name | 3-(4-bromo-3-methylphenyl)-1-(cyclopropylmethyl)-1-propylthiourea |
|---|---|
| PubChem CID | 3837005 |
| Molecular Formula | C15H21BrN2S |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 3-(4-bromo-3-methylphenyl)-1-(cyclopropylmethyl)-1-propylthiourea |
| SMILES | CCCN(CC1CC1)C(=S)Nc1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C15H21BrN2S/c1-3-8-18(10-12-4-5-12)15(19)17-13-6-7-14(16)11(2)9-13/h6-7,9,12H,3-5,8,10H2,1-2H3,(H,17,19) |
| InChIKey | HHVJFCYWZDHROO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|