C20H24N2S — CID 3820363
1-(cyclopropylmethyl)-3-(2-phenylphenyl)-1-propylthiourea (PubChem CID 3820363) has the molecular formula C20H24N2S and a molecular weight of 324.49 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3-(2-phenylphenyl)-1-propylthiourea.
| Compound Name | 1-(cyclopropylmethyl)-3-(2-phenylphenyl)-1-propylthiourea |
|---|---|
| PubChem CID | 3820363 |
| Molecular Formula | C20H24N2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 1-(cyclopropylmethyl)-3-(2-phenylphenyl)-1-propylthiourea |
| SMILES | CCCN(CC1CC1)C(=S)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C20H24N2S/c1-2-14-22(15-16-12-13-16)20(23)21-19-11-7-6-10-18(19)17-8-4-3-5-9-17/h3-11,16H,2,12-15H2,1H3,(H,21,23) |
| InChIKey | HJJGKQARKOYMSK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|