C17H22N2S — CID 19653014
3-naphthalen-1-yl-1,1-dipropylthiourea (PubChem CID 19653014) has the molecular formula C17H22N2S and a molecular weight of 286.44 g/mol. Its IUPAC name is 3-naphthalen-1-yl-1,1-dipropylthiourea.
| Compound Name | 3-naphthalen-1-yl-1,1-dipropylthiourea |
|---|---|
| PubChem CID | 19653014 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 3-naphthalen-1-yl-1,1-dipropylthiourea |
| SMILES | CCCN(CCC)C(=S)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C17H22N2S/c1-3-12-19(13-4-2)17(20)18-16-11-7-9-14-8-5-6-10-15(14)16/h5-11H,3-4,12-13H2,1-2H3,(H,18,20) |
| InChIKey | UCWANDIROBBOKY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|