C38H34N4S2 — CID 102094189
1-methyl-1-[(1R,2R)-2-[methyl(naphthalen-1-ylcarbamothioyl)amino]-1,2-diphenylethyl]-3-naphthalen-1-ylthiourea (PubChem CID 102094189) has the molecular formula C38H34N4S2 and a molecular weight of 610.85 g/mol. Its IUPAC name is 1-methyl-1-[(1R,2R)-2-[methyl(naphthalen-1-ylcarbamothioyl)amino]-1,2-diphenylethyl]-3-naphthalen-1-ylthiourea.
| Compound Name | 1-methyl-1-[(1R,2R)-2-[methyl(naphthalen-1-ylcarbamothioyl)amino]-1,2-diphenylethyl]-3-naphthalen-1-ylthiourea |
|---|---|
| PubChem CID | 102094189 |
| Molecular Formula | C38H34N4S2 |
| Molecular Weight | 610.85 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | 1-methyl-1-[(1R,2R)-2-[methyl(naphthalen-1-ylcarbamothioyl)amino]-1,2-diphenylethyl]-3-naphthalen-1-ylthiourea |
| SMILES | CN(C(=S)Nc1cccc2ccccc12)[C@H](c1ccccc1)[C@@H](c1ccccc1)N(C)C(=S)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C38H34N4S2/c1-41(37(43)39-33-25-13-21-27-15-9-11-23-31(27)33)35(29-17-5-3-6-18-29)36(30-19-7-4-8-20-30)42(2)38(44)40-34-26-14-22-28-16-10-12-24-32(28)34/h3-26,35-36H,1-2H3,(H,39,43)(H,40,44)/t35-,36-/m1/s1 |
| InChIKey | BOGMOMXYPKORQU-LQFQNGICSA-N |
| XLogP | 9.43 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.85 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|