C19H17ClN2S — CID 23826628
3-(2-chlorophenyl)-1-ethyl-1-naphthalen-1-ylthiourea (PubChem CID 23826628) has the molecular formula C19H17ClN2S and a molecular weight of 340.88 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-ethyl-1-naphthalen-1-ylthiourea.
| Compound Name | 3-(2-chlorophenyl)-1-ethyl-1-naphthalen-1-ylthiourea |
|---|---|
| PubChem CID | 23826628 |
| Molecular Formula | C19H17ClN2S |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 3-(2-chlorophenyl)-1-ethyl-1-naphthalen-1-ylthiourea |
| SMILES | CCN(C(=S)Nc1ccccc1Cl)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H17ClN2S/c1-2-22(19(23)21-17-12-6-5-11-16(17)20)18-13-7-9-14-8-3-4-10-15(14)18/h3-13H,2H2,1H3,(H,21,23) |
| InChIKey | GSPBHALAGMJADC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|