C19H15Cl2NO — CID 54499279
3,4-dichloro-N-ethyl-N-naphthalen-1-ylbenzamide (PubChem CID 54499279) has the molecular formula C19H15Cl2NO and a molecular weight of 344.24 g/mol. Its IUPAC name is 3,4-dichloro-N-ethyl-N-naphthalen-1-ylbenzamide.
| Compound Name | 3,4-dichloro-N-ethyl-N-naphthalen-1-ylbenzamide |
|---|---|
| PubChem CID | 54499279 |
| Molecular Formula | C19H15Cl2NO |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 3,4-dichloro-N-ethyl-N-naphthalen-1-ylbenzamide |
| SMILES | CCN(C(=O)c1ccc(Cl)c(Cl)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H15Cl2NO/c1-2-22(19(23)14-10-11-16(20)17(21)12-14)18-9-5-7-13-6-3-4-8-15(13)18/h3-12H,2H2,1H3 |
| InChIKey | YBHLFOSQOVXOGS-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |