C26H22N2O2 — CID 4940825
4-benzamido-N-ethyl-N-naphthalen-1-ylbenzamide (PubChem CID 4940825) has the molecular formula C26H22N2O2 and a molecular weight of 394.47 g/mol. Its IUPAC name is 4-benzamido-N-ethyl-N-naphthalen-1-ylbenzamide.
| Compound Name | 4-benzamido-N-ethyl-N-naphthalen-1-ylbenzamide |
|---|---|
| PubChem CID | 4940825 |
| Molecular Formula | C26H22N2O2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 4-benzamido-N-ethyl-N-naphthalen-1-ylbenzamide |
| SMILES | CCN(C(=O)c1ccc(NC(=O)c2ccccc2)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H22N2O2/c1-2-28(24-14-8-12-19-9-6-7-13-23(19)24)26(30)21-15-17-22(18-16-21)27-25(29)20-10-4-3-5-11-20/h3-18H,2H2,1H3,(H,27,29) |
| InChIKey | VPQNJUAHYQAJPN-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |