C27H24N2O3 — CID 4940850
N-ethyl-4-[(4-methoxybenzoyl)amino]-N-naphthalen-1-ylbenzamide (PubChem CID 4940850) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-ethyl-4-[(4-methoxybenzoyl)amino]-N-naphthalen-1-ylbenzamide.
| Compound Name | N-ethyl-4-[(4-methoxybenzoyl)amino]-N-naphthalen-1-ylbenzamide |
|---|---|
| PubChem CID | 4940850 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | N-ethyl-4-[(4-methoxybenzoyl)amino]-N-naphthalen-1-ylbenzamide |
| SMILES | CCN(C(=O)c1ccc(NC(=O)c2ccc(OC)cc2)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H24N2O3/c1-3-29(25-10-6-8-19-7-4-5-9-24(19)25)27(31)21-11-15-22(16-12-21)28-26(30)20-13-17-23(32-2)18-14-20/h4-18H,3H2,1-2H3,(H,28,30) |
| InChIKey | CSSLBZCHXVNYRW-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |