C28H26N2O2 — CID 26169011
N-ethyl-4-[[2-(2-methylphenyl)acetyl]amino]-N-naphthalen-1-ylbenzamide (PubChem CID 26169011) has the molecular formula C28H26N2O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-ethyl-4-[[2-(2-methylphenyl)acetyl]amino]-N-naphthalen-1-ylbenzamide.
| Compound Name | N-ethyl-4-[[2-(2-methylphenyl)acetyl]amino]-N-naphthalen-1-ylbenzamide |
|---|---|
| PubChem CID | 26169011 |
| Molecular Formula | C28H26N2O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-ethyl-4-[[2-(2-methylphenyl)acetyl]amino]-N-naphthalen-1-ylbenzamide |
| SMILES | CCN(C(=O)c1ccc(NC(=O)Cc2ccccc2C)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H26N2O2/c1-3-30(26-14-8-12-21-10-6-7-13-25(21)26)28(32)22-15-17-24(18-16-22)29-27(31)19-23-11-5-4-9-20(23)2/h4-18H,3,19H2,1-2H3,(H,29,31) |
| InChIKey | KANBRDSAJVPGPQ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |