C29H28N2O5 — CID 4940863
N-[4-[ethyl(naphthalen-1-yl)carbamoyl]phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 4940863) has the molecular formula C29H28N2O5 and a molecular weight of 484.55 g/mol. Its IUPAC name is N-[4-[ethyl(naphthalen-1-yl)carbamoyl]phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[4-[ethyl(naphthalen-1-yl)carbamoyl]phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 4940863 |
| Molecular Formula | C29H28N2O5 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | N-[4-[ethyl(naphthalen-1-yl)carbamoyl]phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | CCN(C(=O)c1ccc(NC(=O)c2cc(OC)c(OC)c(OC)c2)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C29H28N2O5/c1-5-31(24-12-8-10-19-9-6-7-11-23(19)24)29(33)20-13-15-22(16-14-20)30-28(32)21-17-25(34-2)27(36-4)26(18-21)35-3/h6-18H,5H2,1-4H3,(H,30,32) |
| InChIKey | YSTJZMBHQKMIJM-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |