C30H30N2O3 — CID 43878417
3-butan-2-yloxy-N-[4-[ethyl(naphthalen-1-yl)carbamoyl]phenyl]benzamide (PubChem CID 43878417) has the molecular formula C30H30N2O3 and a molecular weight of 466.58 g/mol. Its IUPAC name is 3-butan-2-yloxy-N-[4-[ethyl(naphthalen-1-yl)carbamoyl]phenyl]benzamide.
| Compound Name | 3-butan-2-yloxy-N-[4-[ethyl(naphthalen-1-yl)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 43878417 |
| Molecular Formula | C30H30N2O3 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 3-butan-2-yloxy-N-[4-[ethyl(naphthalen-1-yl)carbamoyl]phenyl]benzamide |
| SMILES | CCC(C)Oc1cccc(C(=O)Nc2ccc(C(=O)N(CC)c3cccc4ccccc34)cc2)c1 |
| InChI | InChI=1S/C30H30N2O3/c1-4-21(3)35-26-13-8-12-24(20-26)29(33)31-25-18-16-23(17-19-25)30(34)32(5-2)28-15-9-11-22-10-6-7-14-27(22)28/h6-21H,4-5H2,1-3H3,(H,31,33) |
| InChIKey | OAYOLAAZUVSTKE-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |