C33H28N2O2 — CID 4940823
4-[(2,2-diphenylacetyl)amino]-N-ethyl-N-naphthalen-1-ylbenzamide (PubChem CID 4940823) has the molecular formula C33H28N2O2 and a molecular weight of 484.60 g/mol. Its IUPAC name is 4-[(2,2-diphenylacetyl)amino]-N-ethyl-N-naphthalen-1-ylbenzamide.
| Compound Name | 4-[(2,2-diphenylacetyl)amino]-N-ethyl-N-naphthalen-1-ylbenzamide |
|---|---|
| PubChem CID | 4940823 |
| Molecular Formula | C33H28N2O2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 4-[(2,2-diphenylacetyl)amino]-N-ethyl-N-naphthalen-1-ylbenzamide |
| SMILES | CCN(C(=O)c1ccc(NC(=O)C(c2ccccc2)c2ccccc2)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C33H28N2O2/c1-2-35(30-19-11-17-24-12-9-10-18-29(24)30)33(37)27-20-22-28(23-21-27)34-32(36)31(25-13-5-3-6-14-25)26-15-7-4-8-16-26/h3-23,31H,2H2,1H3,(H,34,36) |
| InChIKey | ONPVJGGQWLZUJL-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |