C27H23IN2O3 — CID 4940853
N-[4-[ethyl(naphthalen-1-yl)carbamoyl]phenyl]-3-iodo-4-methoxybenzamide (PubChem CID 4940853) has the molecular formula C27H23IN2O3 and a molecular weight of 550.40 g/mol. Its IUPAC name is N-[4-[ethyl(naphthalen-1-yl)carbamoyl]phenyl]-3-iodo-4-methoxybenzamide.
| Compound Name | N-[4-[ethyl(naphthalen-1-yl)carbamoyl]phenyl]-3-iodo-4-methoxybenzamide |
|---|---|
| PubChem CID | 4940853 |
| Molecular Formula | C27H23IN2O3 |
| Molecular Weight | 550.40 g/mol |
| Exact Mass | 550.08 |
| IUPAC Name | N-[4-[ethyl(naphthalen-1-yl)carbamoyl]phenyl]-3-iodo-4-methoxybenzamide |
| SMILES | CCN(C(=O)c1ccc(NC(=O)c2ccc(OC)c(I)c2)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H23IN2O3/c1-3-30(24-10-6-8-18-7-4-5-9-22(18)24)27(32)19-11-14-21(15-12-19)29-26(31)20-13-16-25(33-2)23(28)17-20/h4-17H,3H2,1-2H3,(H,29,31) |
| InChIKey | HJRMRVZWWUXYTB-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.40 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|