C30H28N2O4 — CID 26168850
4-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]-N-ethyl-N-naphthalen-1-ylbenzamide (PubChem CID 26168850) has the molecular formula C30H28N2O4 and a molecular weight of 480.56 g/mol. Its IUPAC name is 4-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]-N-ethyl-N-naphthalen-1-ylbenzamide.
| Compound Name | 4-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]-N-ethyl-N-naphthalen-1-ylbenzamide |
|---|---|
| PubChem CID | 26168850 |
| Molecular Formula | C30H28N2O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 4-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]-N-ethyl-N-naphthalen-1-ylbenzamide |
| SMILES | CCN(C(=O)c1ccc(NC(=O)/C=C/c2ccc(OC)c(OC)c2)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C30H28N2O4/c1-4-32(26-11-7-9-22-8-5-6-10-25(22)26)30(34)23-14-16-24(17-15-23)31-29(33)19-13-21-12-18-27(35-2)28(20-21)36-3/h5-20H,4H2,1-3H3,(H,31,33)/b19-13+ |
| InChIKey | TULXFCDGDMALDB-CPNJWEJPSA-N |
| XLogP | 6.18 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|