C26H20Cl2N2O2 — CID 91500272
2,6-dichloro-N-[3-[ethyl(naphthalen-1-yl)carbamoyl]phenyl]benzamide (PubChem CID 91500272) has the molecular formula C26H20Cl2N2O2 and a molecular weight of 463.36 g/mol. Its IUPAC name is 2,6-dichloro-N-[3-[ethyl(naphthalen-1-yl)carbamoyl]phenyl]benzamide.
| Compound Name | 2,6-dichloro-N-[3-[ethyl(naphthalen-1-yl)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 91500272 |
| Molecular Formula | C26H20Cl2N2O2 |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 2,6-dichloro-N-[3-[ethyl(naphthalen-1-yl)carbamoyl]phenyl]benzamide |
| SMILES | CCN(C(=O)c1cccc(NC(=O)c2c(Cl)cccc2Cl)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H20Cl2N2O2/c1-2-30(23-15-6-9-17-8-3-4-12-20(17)23)26(32)18-10-5-11-19(16-18)29-25(31)24-21(27)13-7-14-22(24)28/h3-16H,2H2,1H3,(H,29,31) |
| InChIKey | HGTCRVWOEKPYCW-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |