About naphthalen-1-ylurea;hydrochloride
naphthalen-1-ylurea;hydrochloride (PubChem CID 141142203) has the molecular formula C11H11ClN2O
and a molecular weight of 222.68 g/mol. Its IUPAC name is naphthalen-1-ylurea;hydrochloride.
Molecular Properties
| Compound Name | naphthalen-1-ylurea;hydrochloride |
| PubChem CID | 141142203 |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | naphthalen-1-ylurea;hydrochloride |
| SMILES | Cl.NC(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C11H10N2O.ClH/c12-11(14)13-10-7-3-5-8-4-1-2-6-9(8)10;/h1-7H,(H3,12,13,14);1H |
| InChIKey | AFHYBLOTYVYIQS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze naphthalen-1-ylurea;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-ylurea;hydrochloride?
The IUPAC name of naphthalen-1-ylurea;hydrochloride (CID 141142203) is naphthalen-1-ylurea;hydrochloride.
What is the SMILES notation for naphthalen-1-ylurea;hydrochloride?
The canonical SMILES for naphthalen-1-ylurea;hydrochloride is Cl.NC(=O)Nc1cccc2ccccc12.
What is the InChIKey of naphthalen-1-ylurea;hydrochloride?
The InChIKey is AFHYBLOTYVYIQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O.ClH/c12-11(14)13-10-7-3-5-8-4-1-2-6-9(8)10;/h1-7H,(H3,12,13,14);1H.
What are the key properties of naphthalen-1-ylurea;hydrochloride?
naphthalen-1-ylurea;hydrochloride has a molecular weight of 222.68 g/mol, XLogP of 2.75, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-ylurea;hydrochloride is sourced from PubChem (CID 141142203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).