C17H18N4O3S — CID 174452527
2-aminobenzenesulfonamide;naphthalen-1-ylurea (PubChem CID 174452527) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is 2-aminobenzenesulfonamide;naphthalen-1-ylurea.
| Compound Name | 2-aminobenzenesulfonamide;naphthalen-1-ylurea |
|---|---|
| PubChem CID | 174452527 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-aminobenzenesulfonamide;naphthalen-1-ylurea |
| SMILES | NC(=O)Nc1cccc2ccccc12.Nc1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C11H10N2O.C6H8N2O2S/c12-11(14)13-10-7-3-5-8-4-1-2-6-9(8)10;7-5-3-1-2-4-6(5)11(8,9)10/h1-7H,(H3,12,13,14);1-4H,7H2,(H2,8,9,10) |
| InChIKey | BXINTPVFDJTSGX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 141.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|