C7H10N4O — CID 18704055
(2,3-diaminophenyl)urea (PubChem CID 18704055) has the molecular formula C7H10N4O and a molecular weight of 166.18 g/mol. Its IUPAC name is (2,3-diaminophenyl)urea.
| Compound Name | (2,3-diaminophenyl)urea |
|---|---|
| PubChem CID | 18704055 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | (2,3-diaminophenyl)urea |
| SMILES | NC(=O)Nc1cccc(N)c1N |
| InChI | InChI=1S/C7H10N4O/c8-4-2-1-3-5(6(4)9)11-7(10)12/h1-3H,8-9H2,(H3,10,11,12) |
| InChIKey | ARNUGAQJQDSOIZ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|