About isoquinolin-8-ylurea
isoquinolin-8-ylurea (PubChem CID 67363282) has the molecular formula C10H9N3O
and a molecular weight of 187.20 g/mol. Its IUPAC name is isoquinolin-8-ylurea.
Molecular Properties
| Compound Name | isoquinolin-8-ylurea |
| PubChem CID | 67363282 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | isoquinolin-8-ylurea |
| SMILES | NC(=O)Nc1cccc2ccncc12 |
| InChI | InChI=1S/C10H9N3O/c11-10(14)13-9-3-1-2-7-4-5-12-6-8(7)9/h1-6H,(H3,11,13,14) |
| InChIKey | GTLJOGPPYKFRBZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze isoquinolin-8-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoquinolin-8-ylurea?
The IUPAC name of isoquinolin-8-ylurea (CID 67363282) is isoquinolin-8-ylurea.
What is the SMILES notation for isoquinolin-8-ylurea?
The canonical SMILES for isoquinolin-8-ylurea is NC(=O)Nc1cccc2ccncc12.
What is the InChIKey of isoquinolin-8-ylurea?
The InChIKey is GTLJOGPPYKFRBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O/c11-10(14)13-9-3-1-2-7-4-5-12-6-8(7)9/h1-6H,(H3,11,13,14).
What are the key properties of isoquinolin-8-ylurea?
isoquinolin-8-ylurea has a molecular weight of 187.20 g/mol, XLogP of 1.73, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for isoquinolin-8-ylurea is sourced from PubChem (CID 67363282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).