C11H7Cl3N2O — CID 22032621
2,2,2-trichloro-N-isoquinolin-8-ylacetamide (PubChem CID 22032621) has the molecular formula C11H7Cl3N2O and a molecular weight of 289.55 g/mol. Its IUPAC name is 2,2,2-trichloro-N-isoquinolin-8-ylacetamide.
| Compound Name | 2,2,2-trichloro-N-isoquinolin-8-ylacetamide |
|---|---|
| PubChem CID | 22032621 |
| Molecular Formula | C11H7Cl3N2O |
| Molecular Weight | 289.55 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | 2,2,2-trichloro-N-isoquinolin-8-ylacetamide |
| SMILES | O=C(Nc1cccc2ccncc12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H7Cl3N2O/c12-11(13,14)10(17)16-9-3-1-2-7-4-5-15-6-8(7)9/h1-6H,(H,16,17) |
| InChIKey | HEHGTAALEHFBRH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|