C11H8Cl3N3O — CID 22337669
N-(3-aminoisoquinolin-5-yl)-2,2,2-trichloroacetamide (PubChem CID 22337669) has the molecular formula C11H8Cl3N3O and a molecular weight of 304.56 g/mol. Its IUPAC name is N-(3-aminoisoquinolin-5-yl)-2,2,2-trichloroacetamide.
| Compound Name | N-(3-aminoisoquinolin-5-yl)-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 22337669 |
| Molecular Formula | C11H8Cl3N3O |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | N-(3-aminoisoquinolin-5-yl)-2,2,2-trichloroacetamide |
| SMILES | Nc1cc2c(NC(=O)C(Cl)(Cl)Cl)cccc2cn1 |
| InChI | InChI=1S/C11H8Cl3N3O/c12-11(13,14)10(18)17-8-3-1-2-6-5-16-9(15)4-7(6)8/h1-5H,(H2,15,16)(H,17,18) |
| InChIKey | CGNHYDSHGVDHPQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|