C29H25F6N5O2 — CID 159770555
1-(3-aminoisoquinolin-5-yl)-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea;1-(1-isocyanatoethyl)-4-(trifluoromethyl)benzene (PubChem CID 159770555) has the molecular formula C29H25F6N5O2 and a molecular weight of 589.54 g/mol. Its IUPAC name is 1-(3-aminoisoquinolin-5-yl)-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea;1-(1-isocyanatoethyl)-4-(trifluoromethyl)benzene.
| Compound Name | 1-(3-aminoisoquinolin-5-yl)-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea;1-(1-isocyanatoethyl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 159770555 |
| Molecular Formula | C29H25F6N5O2 |
| Molecular Weight | 589.54 g/mol |
| Exact Mass | 589.19 |
| IUPAC Name | 1-(3-aminoisoquinolin-5-yl)-3-[1-[4-(trifluoromethyl)phenyl]ethyl]urea;1-(1-isocyanatoethyl)-4-(trifluoromethyl)benzene |
| SMILES | CC(N=C=O)c1ccc(C(F)(F)F)cc1.CC(NC(=O)Nc1cccc2cnc(N)cc12)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F3N4O.C10H8F3NO/c1-11(12-5-7-14(8-6-12)19(20,21)22)25-18(27)26-16-4-2-3-13-10-24-17(23)9-15(13)16;1-7(14-6-15)8-2-4-9(5-3-8)10(11,12)13/h2-11H,1H3,(H2,23,24)(H2,25,26,27);2-5,7H,1H3 |
| InChIKey | NGBCRSDVALTAFV-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.54 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|