C10H8F3NO — CID 154659580
1-[(1S)-1-isocyanatoethyl]-4-(trifluoromethyl)benzene (PubChem CID 154659580) has the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. Its IUPAC name is 1-[(1S)-1-isocyanatoethyl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[(1S)-1-isocyanatoethyl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 154659580 |
| Molecular Formula | C10H8F3NO |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 1-[(1S)-1-isocyanatoethyl]-4-(trifluoromethyl)benzene |
| SMILES | C[C@H](N=C=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H8F3NO/c1-7(14-6-15)8-2-4-9(5-3-8)10(11,12)13/h2-5,7H,1H3/t7-/m0/s1 |
| InChIKey | VTTLXPPZKMEGFM-ZETCQYMHSA-N |
| XLogP | 3.10 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|