C12H13F3O2S — CID 10265545
S-methyl (2S,3S)-3-hydroxy-2-methyl-3-[4-(trifluoromethyl)phenyl]propanethioate (PubChem CID 10265545) has the molecular formula C12H13F3O2S and a molecular weight of 278.30 g/mol. Its IUPAC name is S-methyl (2S,3S)-3-hydroxy-2-methyl-3-[4-(trifluoromethyl)phenyl]propanethioate.
| Compound Name | S-methyl (2S,3S)-3-hydroxy-2-methyl-3-[4-(trifluoromethyl)phenyl]propanethioate |
|---|---|
| PubChem CID | 10265545 |
| Molecular Formula | C12H13F3O2S |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | S-methyl (2S,3S)-3-hydroxy-2-methyl-3-[4-(trifluoromethyl)phenyl]propanethioate |
| SMILES | CSC(=O)[C@@H](C)[C@H](O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3O2S/c1-7(11(17)18-2)10(16)8-3-5-9(6-4-8)12(13,14)15/h3-7,10,16H,1-2H3/t7-,10-/m0/s1 |
| InChIKey | VCHGDHKUJAUZDX-XVKPBYJWSA-N |
| XLogP | 3.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|