C21H20F6O3 — CID 177451871
(1R,2S,4S,5R)-1,5-dihydroxy-2,4-dimethyl-1,5-bis[4-(trifluoromethyl)phenyl]pentan-3-one (PubChem CID 177451871) has the molecular formula C21H20F6O3 and a molecular weight of 434.38 g/mol. Its IUPAC name is (1R,2S,4S,5R)-1,5-dihydroxy-2,4-dimethyl-1,5-bis[4-(trifluoromethyl)phenyl]pentan-3-one.
| Compound Name | (1R,2S,4S,5R)-1,5-dihydroxy-2,4-dimethyl-1,5-bis[4-(trifluoromethyl)phenyl]pentan-3-one |
|---|---|
| PubChem CID | 177451871 |
| Molecular Formula | C21H20F6O3 |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | (1R,2S,4S,5R)-1,5-dihydroxy-2,4-dimethyl-1,5-bis[4-(trifluoromethyl)phenyl]pentan-3-one |
| SMILES | C[C@H](C(=O)[C@@H](C)[C@@H](O)c1ccc(C(F)(F)F)cc1)[C@@H](O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H20F6O3/c1-11(18(29)13-3-7-15(8-4-13)20(22,23)24)17(28)12(2)19(30)14-5-9-16(10-6-14)21(25,26)27/h3-12,18-19,29-30H,1-2H3/t11-,12-,18-,19-/m1/s1 |
| InChIKey | JEQACNHTKFFNPU-DPUOIFSFSA-N |
| XLogP | 5.33 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |